ChemNet > CAS > 465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile
465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile
نام محصول |
3-[2-(3-chlorophenyl)acetyl]benzonitrile |
مترادف |
3-[(3-chlorophenyl)acetyl]benzonitrile |
میدان مغناطیسی |
C15H10ClNO |
وزن مولکولی |
255.699 |
InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
شماره سیایاس |
465514-69-6 |
ساختار مولکولی |
|
تراکم |
1.27g/cm3 |
نقطه ذوب |
87.5℃ |
نقطه غلیان |
416.5°C at 760 mmHg |
ضریب شکست |
1.615 |
نقطه اشتعال |
205.7°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|